C9H17NO2 — CID 130703819
ethyl 1-amino-2,3-dimethylcyclobutane-1-carboxylate (PubChem CID 130703819) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is ethyl 1-amino-2,3-dimethylcyclobutane-1-carboxylate.
| Compound Name | ethyl 1-amino-2,3-dimethylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 130703819 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethyl 1-amino-2,3-dimethylcyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CC(C)C1C |
| InChI | InChI=1S/C9H17NO2/c1-4-12-8(11)9(10)5-6(2)7(9)3/h6-7H,4-5,10H2,1-3H3 |
| InChIKey | QNBCWIMEEACTIK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |