C9H13FO4 — CID 134464391
diethyl 2-fluorocyclopropane-1,1-dicarboxylate (PubChem CID 134464391) has the molecular formula C9H13FO4 and a molecular weight of 204.20 g/mol. Its IUPAC name is diethyl 2-fluorocyclopropane-1,1-dicarboxylate.
| Compound Name | diethyl 2-fluorocyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134464391 |
| Molecular Formula | C9H13FO4 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | diethyl 2-fluorocyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC1F |
| InChI | InChI=1S/C9H13FO4/c1-3-13-7(11)9(5-6(9)10)8(12)14-4-2/h6H,3-5H2,1-2H3 |
| InChIKey | LSQXUAVNYRCHCX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|