C10H16O6S — CID 102568908
diethyl 2-methylsulfonylcyclopropane-1,1-dicarboxylate (PubChem CID 102568908) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is diethyl 2-methylsulfonylcyclopropane-1,1-dicarboxylate.
| Compound Name | diethyl 2-methylsulfonylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102568908 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | diethyl 2-methylsulfonylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC1S(C)(=O)=O |
| InChI | InChI=1S/C10H16O6S/c1-4-15-8(11)10(9(12)16-5-2)6-7(10)17(3,13)14/h7H,4-6H2,1-3H3 |
| InChIKey | HAJREURJAJNPPV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|