C12H18O5 — CID 102053932
diethyl (1R,5S)-2-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate (PubChem CID 102053932) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is diethyl (1R,5S)-2-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate.
| Compound Name | diethyl (1R,5S)-2-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate |
|---|---|
| PubChem CID | 102053932 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | diethyl (1R,5S)-2-oxabicyclo[3.2.0]heptane-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C12H18O5/c1-3-15-10(13)12(11(14)16-4-2)7-8-5-6-17-9(8)12/h8-9H,3-7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | OBLWZZHETZZNCJ-RKDXNWHRSA-N |
| XLogP | 0.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|