C21H26O6 — CID 102053958
diethyl (3aR,6R,7aR)-6-[(E)-2-phenylethenyl]-2,3,3a,4,6,7a-hexahydrofuro[2,3-b]pyran-5,5-dicarboxylate (PubChem CID 102053958) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is diethyl (3aR,6R,7aR)-6-[(E)-2-phenylethenyl]-2,3,3a,4,6,7a-hexahydrofuro[2,3-b]pyran-5,5-dicarboxylate.
| Compound Name | diethyl (3aR,6R,7aR)-6-[(E)-2-phenylethenyl]-2,3,3a,4,6,7a-hexahydrofuro[2,3-b]pyran-5,5-dicarboxylate |
|---|---|
| PubChem CID | 102053958 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | diethyl (3aR,6R,7aR)-6-[(E)-2-phenylethenyl]-2,3,3a,4,6,7a-hexahydrofuro[2,3-b]pyran-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2CCO[C@@H]2O[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H26O6/c1-3-24-19(22)21(20(23)25-4-2)14-16-12-13-26-18(16)27-17(21)11-10-15-8-6-5-7-9-15/h5-11,16-18H,3-4,12-14H2,1-2H3/b11-10+/t16-,17+,18+/m0/s1 |
| InChIKey | UKUIILFCANWOPC-TWUFHKLRSA-N |
| XLogP | 2.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|