About ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate
ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate (PubChem CID 91748647) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate |
| PubChem CID | 91748647 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate |
| SMILES | CCOC(=O)C1OCCOC1/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-2-17-15(16)14-13(18-10-11-19-14)9-8-12-6-4-3-5-7-12/h3-9,13-14H,2,10-11H2,1H3/b9-8+ |
| InChIKey | OEYIYHOTRRKBSS-CMDGGOBGSA-N |
| XLogP | 2.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate?
The IUPAC name of ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate (CID 91748647) is ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate.
What is the SMILES notation for ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate?
The canonical SMILES for ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate is CCOC(=O)C1OCCOC1/C=C/c1ccccc1.
What is the InChIKey of ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate?
The InChIKey is OEYIYHOTRRKBSS-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H18O4/c1-2-17-15(16)14-13(18-10-11-19-14)9-8-12-6-4-3-5-7-12/h3-9,13-14H,2,10-11H2,1H3/b9-8+.
What are the key properties of ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate?
ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate has a molecular weight of 262.31 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(E)-2-phenylethenyl]-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 91748647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).