C19H24O4 — CID 101202223
diethyl 2-[(Z)-1-phenylprop-1-enyl]cyclobutane-1,1-dicarboxylate (PubChem CID 101202223) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is diethyl 2-[(Z)-1-phenylprop-1-enyl]cyclobutane-1,1-dicarboxylate.
| Compound Name | diethyl 2-[(Z)-1-phenylprop-1-enyl]cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101202223 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | diethyl 2-[(Z)-1-phenylprop-1-enyl]cyclobutane-1,1-dicarboxylate |
| SMILES | C/C=C(\c1ccccc1)C1CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H24O4/c1-4-15(14-10-8-7-9-11-14)16-12-13-19(16,17(20)22-5-2)18(21)23-6-3/h4,7-11,16H,5-6,12-13H2,1-3H3/b15-4+ |
| InChIKey | WUTFYBQIJZMLGT-SYZQJQIISA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|