C20H26O5 — CID 101202224
diethyl 2-[(Z)-1-(4-methoxyphenyl)prop-1-enyl]cyclobutane-1,1-dicarboxylate (PubChem CID 101202224) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is diethyl 2-[(Z)-1-(4-methoxyphenyl)prop-1-enyl]cyclobutane-1,1-dicarboxylate.
| Compound Name | diethyl 2-[(Z)-1-(4-methoxyphenyl)prop-1-enyl]cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101202224 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | diethyl 2-[(Z)-1-(4-methoxyphenyl)prop-1-enyl]cyclobutane-1,1-dicarboxylate |
| SMILES | C/C=C(\c1ccc(OC)cc1)C1CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26O5/c1-5-16(14-8-10-15(23-4)11-9-14)17-12-13-20(17,18(21)24-6-2)19(22)25-7-3/h5,8-11,17H,6-7,12-13H2,1-4H3/b16-5+ |
| InChIKey | XGYUCXMIDGGQNQ-FZSIALSZSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|