C19H26O6 — CID 123656110
cis-2-ethoxyethyl (1S,2R)-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxylate (PubChem CID 123656110) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is cis-2-ethoxyethyl (1S,2R)-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxylate.
| Compound Name | cis-2-ethoxyethyl (1S,2R)-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123656110 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | cis-2-ethoxyethyl (1S,2R)-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxylate |
| SMILES | CCOCCOC(=O)[C@H]1CCCC[C@]1(O)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26O6/c1-3-24-12-13-25-18(21)16-6-4-5-11-19(16,22)17(20)14-7-9-15(23-2)10-8-14/h7-10,16,22H,3-6,11-13H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | GZTXWCAOQIAAPE-VQIMIIECSA-N |
| XLogP | 2.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|