C22H35NO7Si — CID 59289873
N-[3-[diethoxy(hydroxy)silyl]propyl]-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxamide (PubChem CID 59289873) has the molecular formula C22H35NO7Si and a molecular weight of 453.61 g/mol. Its IUPAC name is N-[3-[diethoxy(hydroxy)silyl]propyl]-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxamide.
| Compound Name | N-[3-[diethoxy(hydroxy)silyl]propyl]-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59289873 |
| Molecular Formula | C22H35NO7Si |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[3-[diethoxy(hydroxy)silyl]propyl]-2-hydroxy-2-(4-methoxybenzoyl)cyclohexane-1-carboxamide |
| SMILES | CCO[Si](O)(CCCNC(=O)C1CCCCC1(O)C(=O)c1ccc(OC)cc1)OCC |
| InChI | InChI=1S/C22H35NO7Si/c1-4-29-31(27,30-5-2)16-8-15-23-21(25)19-9-6-7-14-22(19,26)20(24)17-10-12-18(28-3)13-11-17/h10-13,19,26-27H,4-9,14-16H2,1-3H3,(H,23,25) |
| InChIKey | ROVSXMRXOREJJF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|