C16H22N2O4 — CID 7296512
2-ethoxyethyl N'-cyclopropyl-N-(4-methoxybenzoyl)carbamimidate (PubChem CID 7296512) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-ethoxyethyl N'-cyclopropyl-N-(4-methoxybenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-cyclopropyl-N-(4-methoxybenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7296512 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-ethoxyethyl N'-cyclopropyl-N-(4-methoxybenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\C1CC1)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-21-10-11-22-16(17-13-6-7-13)18-15(19)12-4-8-14(20-2)9-5-12/h4-5,8-9,13H,3,6-7,10-11H2,1-2H3,(H,17,18,19) |
| InChIKey | GFZCJQULOWCHKC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|