C18H26N2O5 — CID 7362580
2-ethoxyethyl N-(4-methoxybenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate (PubChem CID 7362580) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-ethoxyethyl N-(4-methoxybenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate.
| Compound Name | 2-ethoxyethyl N-(4-methoxybenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate |
|---|---|
| PubChem CID | 7362580 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-ethoxyethyl N-(4-methoxybenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate |
| SMILES | CCOCCO/C(=N\C[C@@H]1CCCO1)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-3-23-11-12-25-18(19-13-16-5-4-10-24-16)20-17(21)14-6-8-15(22-2)9-7-14/h6-9,16H,3-5,10-13H2,1-2H3,(H,19,20,21)/t16-/m0/s1 |
| InChIKey | QJPIOXQVLBBDHW-INIZCTEOSA-N |
| XLogP | 2.01 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|