C14H16Cl2N2O3 — CID 7261503
methyl N-(3,4-dichlorobenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate (PubChem CID 7261503) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is methyl N-(3,4-dichlorobenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate.
| Compound Name | methyl N-(3,4-dichlorobenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate |
|---|---|
| PubChem CID | 7261503 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl N-(3,4-dichlorobenzoyl)-N'-[[(2S)-oxolan-2-yl]methyl]carbamimidate |
| SMILES | CO/C(=N\C[C@@H]1CCCO1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-20-14(17-8-10-3-2-6-21-10)18-13(19)9-4-5-11(15)12(16)7-9/h4-5,7,10H,2-3,6,8H2,1H3,(H,17,18,19)/t10-/m0/s1 |
| InChIKey | RWPVIROUBSGXKV-JTQLQIEISA-N |
| XLogP | 2.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|