C18H30N3O4+ — CID 7271327
3-[[2-ethoxyethoxy-[(4-methoxybenzoyl)amino]methylidene]amino]propyl-dimethylazanium (PubChem CID 7271327) has the molecular formula C18H30N3O4+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[[2-ethoxyethoxy-[(4-methoxybenzoyl)amino]methylidene]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-ethoxyethoxy-[(4-methoxybenzoyl)amino]methylidene]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7271327 |
| Molecular Formula | C18H30N3O4+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-[[2-ethoxyethoxy-[(4-methoxybenzoyl)amino]methylidene]amino]propyl-dimethylazanium |
| SMILES | CCOCCO/C(=N\CCC[NH+](C)C)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H29N3O4/c1-5-24-13-14-25-18(19-11-6-12-21(2)3)20-17(22)15-7-9-16(23-4)10-8-15/h7-10H,5-6,11-14H2,1-4H3,(H,19,20,22)/p+1 |
| InChIKey | WXVZCGZZZMUIKX-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|