C18H28N2O4 — CID 7338069
2-ethoxyethyl N-(3-methoxybenzoyl)-N'-(3-methylbutyl)carbamimidate (PubChem CID 7338069) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-ethoxyethyl N-(3-methoxybenzoyl)-N'-(3-methylbutyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N-(3-methoxybenzoyl)-N'-(3-methylbutyl)carbamimidate |
|---|---|
| PubChem CID | 7338069 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-ethoxyethyl N-(3-methoxybenzoyl)-N'-(3-methylbutyl)carbamimidate |
| SMILES | CCOCCO/C(=N\CCC(C)C)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-5-23-11-12-24-18(19-10-9-14(2)3)20-17(21)15-7-6-8-16(13-15)22-4/h6-8,13-14H,5,9-12H2,1-4H3,(H,19,20,21) |
| InChIKey | JXJIYODFAYOCJK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|