C21H34FN3O3 — CID 7349979
2-ethoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(3-fluorobenzoyl)carbamimidate (PubChem CID 7349979) has the molecular formula C21H34FN3O3 and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-ethoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(3-fluorobenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(3-fluorobenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7349979 |
| Molecular Formula | C21H34FN3O3 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-ethoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(3-fluorobenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\[C@H](C)CCCN(CC)CC)NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H34FN3O3/c1-5-25(6-2)13-9-10-17(4)23-21(28-15-14-27-7-3)24-20(26)18-11-8-12-19(22)16-18/h8,11-12,16-17H,5-7,9-10,13-15H2,1-4H3,(H,23,24,26)/t17-/m1/s1 |
| InChIKey | RSDAECXABLPTGX-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|