C18H28ClN3O2 — CID 4551704
methyl N-(2-chlorobenzoyl)-N'-[5-(diethylamino)pentan-2-yl]carbamimidate (PubChem CID 4551704) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is methyl N-(2-chlorobenzoyl)-N'-[5-(diethylamino)pentan-2-yl]carbamimidate.
| Compound Name | methyl N-(2-chlorobenzoyl)-N'-[5-(diethylamino)pentan-2-yl]carbamimidate |
|---|---|
| PubChem CID | 4551704 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | methyl N-(2-chlorobenzoyl)-N'-[5-(diethylamino)pentan-2-yl]carbamimidate |
| SMILES | CCN(CC)CCCC(C)/N=C(/NC(=O)c1ccccc1Cl)OC |
| InChI | InChI=1S/C18H28ClN3O2/c1-5-22(6-2)13-9-10-14(3)20-18(24-4)21-17(23)15-11-7-8-12-16(15)19/h7-8,11-12,14H,5-6,9-10,13H2,1-4H3,(H,20,21,23) |
| InChIKey | NDLVHPAOZQOOAS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|