C20H32ClN3O2 — CID 7297073
propyl N-(2-chlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate (PubChem CID 7297073) has the molecular formula C20H32ClN3O2 and a molecular weight of 381.95 g/mol. Its IUPAC name is propyl N-(2-chlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate.
| Compound Name | propyl N-(2-chlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate |
|---|---|
| PubChem CID | 7297073 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | propyl N-(2-chlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate |
| SMILES | CCCO/C(=N\[C@H](C)CCCN(CC)CC)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H32ClN3O2/c1-5-15-26-20(22-16(4)11-10-14-24(6-2)7-3)23-19(25)17-12-8-9-13-18(17)21/h8-9,12-13,16H,5-7,10-11,14-15H2,1-4H3,(H,22,23,25)/t16-/m1/s1 |
| InChIKey | UVWXRZKAXOXHSX-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|