C18H31N3O4 — CID 7338343
2-methoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(furan-2-carbonyl)carbamimidate (PubChem CID 7338343) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-methoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(furan-2-carbonyl)carbamimidate.
| Compound Name | 2-methoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(furan-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 7338343 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 2-methoxyethyl N'-[(2R)-5-(diethylamino)pentan-2-yl]-N-(furan-2-carbonyl)carbamimidate |
| SMILES | CCN(CC)CCC[C@@H](C)/N=C(/NC(=O)c1ccco1)OCCOC |
| InChI | InChI=1S/C18H31N3O4/c1-5-21(6-2)11-7-9-15(3)19-18(25-14-13-23-4)20-17(22)16-10-8-12-24-16/h8,10,12,15H,5-7,9,11,13-14H2,1-4H3,(H,19,20,22)/t15-/m1/s1 |
| InChIKey | ILSDJIVKPTZDGZ-OAHLLOKOSA-N |
| XLogP | 2.54 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|