C12H18N2O3 — CID 7439494
ethyl N'-[(2S)-butan-2-yl]-N-(furan-2-carbonyl)carbamimidate (PubChem CID 7439494) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is ethyl N'-[(2S)-butan-2-yl]-N-(furan-2-carbonyl)carbamimidate.
| Compound Name | ethyl N'-[(2S)-butan-2-yl]-N-(furan-2-carbonyl)carbamimidate |
|---|---|
| PubChem CID | 7439494 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | ethyl N'-[(2S)-butan-2-yl]-N-(furan-2-carbonyl)carbamimidate |
| SMILES | CCO/C(=N\[C@@H](C)CC)NC(=O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O3/c1-4-9(3)13-12(16-5-2)14-11(15)10-7-6-8-17-10/h6-9H,4-5H2,1-3H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | PWHMVSSLIVJWJQ-VIFPVBQESA-N |
| XLogP | 2.20 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|