C17H26N2O2 — CID 46126214
2-methylpropyl N'-butan-2-yl-N-(3-methylbenzoyl)carbamimidate (PubChem CID 46126214) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-methylpropyl N'-butan-2-yl-N-(3-methylbenzoyl)carbamimidate.
| Compound Name | 2-methylpropyl N'-butan-2-yl-N-(3-methylbenzoyl)carbamimidate |
|---|---|
| PubChem CID | 46126214 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-methylpropyl N'-butan-2-yl-N-(3-methylbenzoyl)carbamimidate |
| SMILES | CCC(C)/N=C(/NC(=O)c1cccc(C)c1)OCC(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-6-14(5)18-17(21-11-12(2)3)19-16(20)15-9-7-8-13(4)10-15/h7-10,12,14H,6,11H2,1-5H3,(H,18,19,20) |
| InChIKey | SZGAMEFDTVOFCT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|