C18H21NO2 — CID 17079530
3-methyl-N-[3-(2-methylpropoxy)phenyl]benzamide (PubChem CID 17079530) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-methylpropoxy)phenyl]benzamide.
| Compound Name | 3-methyl-N-[3-(2-methylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17079530 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-methyl-N-[3-(2-methylpropoxy)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(OCC(C)C)c2)c1 |
| InChI | InChI=1S/C18H21NO2/c1-13(2)12-21-17-9-5-8-16(11-17)19-18(20)15-7-4-6-14(3)10-15/h4-11,13H,12H2,1-3H3,(H,19,20) |
| InChIKey | SRQMIWSGRFLNSU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |