C16H21F3N2O2 — CID 7238521
ethyl N'-[(2S)-3-methylbutan-2-yl]-N-[3-(trifluoromethyl)benzoyl]carbamimidate (PubChem CID 7238521) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is ethyl N'-[(2S)-3-methylbutan-2-yl]-N-[3-(trifluoromethyl)benzoyl]carbamimidate.
| Compound Name | ethyl N'-[(2S)-3-methylbutan-2-yl]-N-[3-(trifluoromethyl)benzoyl]carbamimidate |
|---|---|
| PubChem CID | 7238521 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl N'-[(2S)-3-methylbutan-2-yl]-N-[3-(trifluoromethyl)benzoyl]carbamimidate |
| SMILES | CCO/C(=N\[C@@H](C)C(C)C)NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-5-23-15(20-11(4)10(2)3)21-14(22)12-7-6-8-13(9-12)16(17,18)19/h6-11H,5H2,1-4H3,(H,20,21,22)/t11-/m0/s1 |
| InChIKey | HEQSPYVWGNPNJE-NSHDSACASA-N |
| XLogP | 3.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|