About propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate
propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate (PubChem CID 7288574) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate.
Molecular Properties
| Compound Name | propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate |
| PubChem CID | 7288574 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate |
| SMILES | COc1cccc(C(=O)N/C(=N\[C@@H](C)C(C)C)OC(C)C)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-11(2)13(5)18-17(22-12(3)4)19-16(20)14-8-7-9-15(10-14)21-6/h7-13H,1-6H3,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | PDBGDWGVTYVKFH-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate?
The IUPAC name of propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate (CID 7288574) is propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate.
What is the SMILES notation for propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate?
The canonical SMILES for propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate is COc1cccc(C(=O)N/C(=N\[C@@H](C)C(C)C)OC(C)C)c1.
What is the InChIKey of propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate?
The InChIKey is PDBGDWGVTYVKFH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-11(2)13(5)18-17(22-12(3)4)19-16(20)14-8-7-9-15(10-14)21-6/h7-13H,1-6H3,(H,18,19,20)/t13-/m0/s1.
What are the key properties of propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate?
propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate has a molecular weight of 306.41 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(3-methoxybenzoyl)-N'-[(2S)-3-methylbutan-2-yl]carbamimidate is sourced from PubChem (CID 7288574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).