C20H31F3N3O2+ — CID 7495264
[(4S)-4-[[ethoxy-[[3-(trifluoromethyl)benzoyl]amino]methylidene]amino]pentyl]-diethylazanium (PubChem CID 7495264) has the molecular formula C20H31F3N3O2+ and a molecular weight of 402.48 g/mol. Its IUPAC name is [(4S)-4-[[ethoxy-[[3-(trifluoromethyl)benzoyl]amino]methylidene]amino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[[ethoxy-[[3-(trifluoromethyl)benzoyl]amino]methylidene]amino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7495264 |
| Molecular Formula | C20H31F3N3O2+ |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(4S)-4-[[ethoxy-[[3-(trifluoromethyl)benzoyl]amino]methylidene]amino]pentyl]-diethylazanium |
| SMILES | CCO/C(=N\[C@@H](C)CCC[NH+](CC)CC)NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H30F3N3O2/c1-5-26(6-2)13-9-10-15(4)24-19(28-7-3)25-18(27)16-11-8-12-17(14-16)20(21,22)23/h8,11-12,14-15H,5-7,9-10,13H2,1-4H3,(H,24,25,27)/p+1/t15-/m0/s1 |
| InChIKey | JLHUGRHVRJSAHA-HNNXBMFYSA-O |
| XLogP | 2.92 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|