C20H34N3O2+ — CID 7397613
[(4R)-4-[[ethoxy-[(2-methylbenzoyl)amino]methylidene]amino]pentyl]-diethylazanium (PubChem CID 7397613) has the molecular formula C20H34N3O2+ and a molecular weight of 348.51 g/mol. Its IUPAC name is [(4R)-4-[[ethoxy-[(2-methylbenzoyl)amino]methylidene]amino]pentyl]-diethylazanium.
| Compound Name | [(4R)-4-[[ethoxy-[(2-methylbenzoyl)amino]methylidene]amino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7397613 |
| Molecular Formula | C20H34N3O2+ |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | [(4R)-4-[[ethoxy-[(2-methylbenzoyl)amino]methylidene]amino]pentyl]-diethylazanium |
| SMILES | CCO/C(=N\[C@H](C)CCC[NH+](CC)CC)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C20H33N3O2/c1-6-23(7-2)15-11-13-17(5)21-20(25-8-3)22-19(24)18-14-10-9-12-16(18)4/h9-10,12,14,17H,6-8,11,13,15H2,1-5H3,(H,21,22,24)/p+1/t17-/m1/s1 |
| InChIKey | NMYFXTYRODOCLS-QGZVFWFLSA-O |
| XLogP | 2.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|