C20H24N2O2 — CID 4557341
propan-2-yl N-(2-methylbenzoyl)-N'-(1-phenylethyl)carbamimidate (PubChem CID 4557341) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is propan-2-yl N-(2-methylbenzoyl)-N'-(1-phenylethyl)carbamimidate.
| Compound Name | propan-2-yl N-(2-methylbenzoyl)-N'-(1-phenylethyl)carbamimidate |
|---|---|
| PubChem CID | 4557341 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | propan-2-yl N-(2-methylbenzoyl)-N'-(1-phenylethyl)carbamimidate |
| SMILES | Cc1ccccc1C(=O)N/C(=N\C(C)c1ccccc1)OC(C)C |
| InChI | InChI=1S/C20H24N2O2/c1-14(2)24-20(21-16(4)17-11-6-5-7-12-17)22-19(23)18-13-9-8-10-15(18)3/h5-14,16H,1-4H3,(H,21,22,23) |
| InChIKey | GBLGWRVKMIMSES-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|