C21H26N2O3 — CID 7296539
2-ethoxyethyl N-(4-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate (PubChem CID 7296539) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-ethoxyethyl N-(4-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate.
| Compound Name | 2-ethoxyethyl N-(4-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
|---|---|
| PubChem CID | 7296539 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-ethoxyethyl N-(4-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
| SMILES | CCOCCO/C(=N\[C@@H](C)c1ccccc1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-25-14-15-26-21(22-17(3)18-8-6-5-7-9-18)23-20(24)19-12-10-16(2)11-13-19/h5-13,17H,4,14-15H2,1-3H3,(H,22,23,24)/t17-/m0/s1 |
| InChIKey | HBQZUOSPOOVWLG-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|