C19H20N2O4 — CID 7361437
ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-[(1S)-1-phenylethyl]carbamimidate (PubChem CID 7361437) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-[(1S)-1-phenylethyl]carbamimidate.
| Compound Name | ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
|---|---|
| PubChem CID | 7361437 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
| SMILES | CCO/C(=N\[C@@H](C)c1ccccc1)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O4/c1-3-23-19(20-13(2)14-7-5-4-6-8-14)21-18(22)15-9-10-16-17(11-15)25-12-24-16/h4-11,13H,3,12H2,1-2H3,(H,20,21,22)/t13-/m0/s1 |
| InChIKey | ASYCTQNEFLNVCH-ZDUSSCGKSA-N |
| XLogP | 3.30 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|