C18H19N3O4 — CID 7347971
propyl N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-3-ylmethyl)carbamimidate (PubChem CID 7347971) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is propyl N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-3-ylmethyl)carbamimidate.
| Compound Name | propyl N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
|---|---|
| PubChem CID | 7347971 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | propyl N-(1,3-benzodioxole-5-carbonyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
| SMILES | CCCO/C(=N\Cc1cccnc1)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19N3O4/c1-2-8-23-18(20-11-13-4-3-7-19-10-13)21-17(22)14-5-6-15-16(9-14)25-12-24-15/h3-7,9-10H,2,8,11-12H2,1H3,(H,20,21,22) |
| InChIKey | VHLVAOGSCBCSRL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|