C15H20N2O4 — CID 7373607
ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-methylpropyl)carbamimidate (PubChem CID 7373607) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-methylpropyl)carbamimidate.
| Compound Name | ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-methylpropyl)carbamimidate |
|---|---|
| PubChem CID | 7373607 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-methylpropyl)carbamimidate |
| SMILES | CCO/C(=N\CC(C)C)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O4/c1-4-19-15(16-8-10(2)3)17-14(18)11-5-6-12-13(7-11)21-9-20-12/h5-7,10H,4,8-9H2,1-3H3,(H,16,17,18) |
| InChIKey | AYGMMNUWGWPYIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|