C19H28N2O4 — CID 42665445
2-methylpropyl N-(1,3-benzodioxole-5-carbonyl)-N'-hexylcarbamimidate (PubChem CID 42665445) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-methylpropyl N-(1,3-benzodioxole-5-carbonyl)-N'-hexylcarbamimidate.
| Compound Name | 2-methylpropyl N-(1,3-benzodioxole-5-carbonyl)-N'-hexylcarbamimidate |
|---|---|
| PubChem CID | 42665445 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-methylpropyl N-(1,3-benzodioxole-5-carbonyl)-N'-hexylcarbamimidate |
| SMILES | CCCCCC/N=C(/NC(=O)c1ccc2c(c1)OCO2)OCC(C)C |
| InChI | InChI=1S/C19H28N2O4/c1-4-5-6-7-10-20-19(23-12-14(2)3)21-18(22)15-8-9-16-17(11-15)25-13-24-16/h8-9,11,14H,4-7,10,12-13H2,1-3H3,(H,20,21,22) |
| InChIKey | UKRBBRZUFBCXHS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|