C12H16N2O3 — CID 118060240
N'-butyl-N-hydroxy-1,3-benzodioxole-5-carboximidamide (PubChem CID 118060240) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N'-butyl-N-hydroxy-1,3-benzodioxole-5-carboximidamide.
| Compound Name | N'-butyl-N-hydroxy-1,3-benzodioxole-5-carboximidamide |
|---|---|
| PubChem CID | 118060240 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N'-butyl-N-hydroxy-1,3-benzodioxole-5-carboximidamide |
| SMILES | CCCC/N=C(\NO)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O3/c1-2-3-6-13-12(14-15)9-4-5-10-11(7-9)17-8-16-10/h4-5,7,15H,2-3,6,8H2,1H3,(H,13,14) |
| InChIKey | DFPSTAYFIRUMPD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|