C12H14O2 — CID 95366716
5-[(E)-pent-2-en-3-yl]-1,3-benzodioxole (PubChem CID 95366716) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 5-[(E)-pent-2-en-3-yl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-pent-2-en-3-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 95366716 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 5-[(E)-pent-2-en-3-yl]-1,3-benzodioxole |
| SMILES | C/C=C(\CC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H14O2/c1-3-9(4-2)10-5-6-11-12(7-10)14-8-13-11/h3,5-7H,4,8H2,1-2H3/b9-3+ |
| InChIKey | NIMKYVIZYOWLKV-YCRREMRBSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |