C19H18O4 — CID 154290706
[4-[2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate (PubChem CID 154290706) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 154290706 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)but-1-enyl]phenyl] acetate |
| SMILES | CCC(=Cc1ccc(OC(C)=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18O4/c1-3-15(16-6-9-18-19(11-16)22-12-21-18)10-14-4-7-17(8-5-14)23-13(2)20/h4-11H,3,12H2,1-2H3 |
| InChIKey | DVKLENOBDTWOKL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|