C12H14O2 — CID 89352282
6-but-1-en-2-yl-2,3-dihydro-1,4-benzodioxine (PubChem CID 89352282) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 6-but-1-en-2-yl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-but-1-en-2-yl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 89352282 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 6-but-1-en-2-yl-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=C(CC)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14O2/c1-3-9(2)10-4-5-11-12(8-10)14-7-6-13-11/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | SHOVMTCQWPHLNN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |