C12H14O — CID 145466674
6-but-1-en-2-yl-2,3-dihydro-1-benzofuran (PubChem CID 145466674) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 6-but-1-en-2-yl-2,3-dihydro-1-benzofuran.
| Compound Name | 6-but-1-en-2-yl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 145466674 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 6-but-1-en-2-yl-2,3-dihydro-1-benzofuran |
| SMILES | C=C(CC)c1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C12H14O/c1-3-9(2)11-5-4-10-6-7-13-12(10)8-11/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | JDLWJEULZMKHKM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |