C16H22N3O5+ — CID 7350093
methyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-morpholin-4-ium-4-ylethyl)carbamimidate (PubChem CID 7350093) has the molecular formula C16H22N3O5+ and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-morpholin-4-ium-4-ylethyl)carbamimidate.
| Compound Name | methyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-morpholin-4-ium-4-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 7350093 |
| Molecular Formula | C16H22N3O5+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl N-(1,3-benzodioxole-5-carbonyl)-N'-(2-morpholin-4-ium-4-ylethyl)carbamimidate |
| SMILES | CO/C(=N\CC[NH+]1CCOCC1)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H21N3O5/c1-21-16(17-4-5-19-6-8-22-9-7-19)18-15(20)12-2-3-13-14(10-12)24-11-23-13/h2-3,10H,4-9,11H2,1H3,(H,17,18,20)/p+1 |
| InChIKey | XZICHBVQAFIBKY-UHFFFAOYSA-O |
| XLogP | -0.94 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|