C15H14FN3O2 — CID 4125300
methyl N-(4-fluorobenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate (PubChem CID 4125300) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is methyl N-(4-fluorobenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate.
| Compound Name | methyl N-(4-fluorobenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
|---|---|
| PubChem CID | 4125300 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | methyl N-(4-fluorobenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
| SMILES | CO/C(=N\Cc1cccnc1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3O2/c1-21-15(18-10-11-3-2-8-17-9-11)19-14(20)12-4-6-13(16)7-5-12/h2-9H,10H2,1H3,(H,18,19,20) |
| InChIKey | GXBCKUKQPMRACS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|