C17H19N3O3 — CID 7212555
ethyl N-(3-methoxybenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate (PubChem CID 7212555) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl N-(3-methoxybenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate.
| Compound Name | ethyl N-(3-methoxybenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
|---|---|
| PubChem CID | 7212555 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl N-(3-methoxybenzoyl)-N'-(pyridin-3-ylmethyl)carbamimidate |
| SMILES | CCO/C(=N\Cc1cccnc1)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-3-23-17(19-12-13-6-5-9-18-11-13)20-16(21)14-7-4-8-15(10-14)22-2/h4-11H,3,12H2,1-2H3,(H,19,20,21) |
| InChIKey | BZJGKFUBCJUWOH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|