C19H22N2O2 — CID 7338518
ethyl N-(2-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate (PubChem CID 7338518) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is ethyl N-(2-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate.
| Compound Name | ethyl N-(2-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
|---|---|
| PubChem CID | 7338518 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl N-(2-methylbenzoyl)-N'-[(1S)-1-phenylethyl]carbamimidate |
| SMILES | CCO/C(=N\[C@@H](C)c1ccccc1)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C19H22N2O2/c1-4-23-19(20-15(3)16-11-6-5-7-12-16)21-18(22)17-13-9-8-10-14(17)2/h5-13,15H,4H2,1-3H3,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | YBUJIROEINGSRF-HNNXBMFYSA-N |
| XLogP | 3.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|