C17H24N2O3 — CID 5145915
2-ethoxyethyl N'-(cyclopropylmethyl)-N-(4-methylbenzoyl)carbamimidate (PubChem CID 5145915) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-ethoxyethyl N'-(cyclopropylmethyl)-N-(4-methylbenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-(cyclopropylmethyl)-N-(4-methylbenzoyl)carbamimidate |
|---|---|
| PubChem CID | 5145915 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-ethoxyethyl N'-(cyclopropylmethyl)-N-(4-methylbenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\CC1CC1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-3-21-10-11-22-17(18-12-14-6-7-14)19-16(20)15-8-4-13(2)5-9-15/h4-5,8-9,14H,3,6-7,10-12H2,1-2H3,(H,18,19,20) |
| InChIKey | JEWGNWGVNCGMSS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|