C16H25N3O2 — CID 7256758
ethyl N'-[3-(dimethylamino)propyl]-N-(4-methylbenzoyl)carbamimidate (PubChem CID 7256758) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethyl N'-[3-(dimethylamino)propyl]-N-(4-methylbenzoyl)carbamimidate.
| Compound Name | ethyl N'-[3-(dimethylamino)propyl]-N-(4-methylbenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7256758 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl N'-[3-(dimethylamino)propyl]-N-(4-methylbenzoyl)carbamimidate |
| SMILES | CCO/C(=N\CCCN(C)C)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-21-16(17-11-6-12-19(3)4)18-15(20)14-9-7-13(2)8-10-14/h7-10H,5-6,11-12H2,1-4H3,(H,17,18,20) |
| InChIKey | DAUGHEKBIZUPTO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|