C16H23FN3O2+ — CID 7412384
ethyl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate (PubChem CID 7412384) has the molecular formula C16H23FN3O2+ and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate.
| Compound Name | ethyl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 7412384 |
| Molecular Formula | C16H23FN3O2+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ium-1-ylethyl)carbamimidate |
| SMILES | CCO/C(=N\CC[NH+]1CCCC1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FN3O2/c1-2-22-16(18-9-12-20-10-3-4-11-20)19-15(21)13-5-7-14(17)8-6-13/h5-8H,2-4,9-12H2,1H3,(H,18,19,21)/p+1 |
| InChIKey | ACZYPFVRNSQHFY-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|