C16H23FN2O3 — CID 7360519
2-methylpropyl N-(4-fluorobenzoyl)-N'-(3-methoxypropyl)carbamimidate (PubChem CID 7360519) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-methylpropyl N-(4-fluorobenzoyl)-N'-(3-methoxypropyl)carbamimidate.
| Compound Name | 2-methylpropyl N-(4-fluorobenzoyl)-N'-(3-methoxypropyl)carbamimidate |
|---|---|
| PubChem CID | 7360519 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-methylpropyl N-(4-fluorobenzoyl)-N'-(3-methoxypropyl)carbamimidate |
| SMILES | COCCC/N=C(/NC(=O)c1ccc(F)cc1)OCC(C)C |
| InChI | InChI=1S/C16H23FN2O3/c1-12(2)11-22-16(18-9-4-10-21-3)19-15(20)13-5-7-14(17)8-6-13/h5-8,12H,4,9-11H2,1-3H3,(H,18,19,20) |
| InChIKey | ZOMGXISJHYJXNS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|