C20H22Cl2N2O3 — CID 46125593
2-methoxyethyl N-(3,4-dichlorobenzoyl)-N'-(3-phenylpropyl)carbamimidate (PubChem CID 46125593) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-methoxyethyl N-(3,4-dichlorobenzoyl)-N'-(3-phenylpropyl)carbamimidate.
| Compound Name | 2-methoxyethyl N-(3,4-dichlorobenzoyl)-N'-(3-phenylpropyl)carbamimidate |
|---|---|
| PubChem CID | 46125593 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-methoxyethyl N-(3,4-dichlorobenzoyl)-N'-(3-phenylpropyl)carbamimidate |
| SMILES | COCCO/C(=N\CCCc1ccccc1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-26-12-13-27-20(23-11-5-8-15-6-3-2-4-7-15)24-19(25)16-9-10-17(21)18(22)14-16/h2-4,6-7,9-10,14H,5,8,11-13H2,1H3,(H,23,24,25) |
| InChIKey | NBCMLJODIRBXCZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|