C20H31Cl2N3O2 — CID 7418573
propyl N-(3,4-dichlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate (PubChem CID 7418573) has the molecular formula C20H31Cl2N3O2 and a molecular weight of 416.39 g/mol. Its IUPAC name is propyl N-(3,4-dichlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate.
| Compound Name | propyl N-(3,4-dichlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate |
|---|---|
| PubChem CID | 7418573 |
| Molecular Formula | C20H31Cl2N3O2 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | propyl N-(3,4-dichlorobenzoyl)-N'-[(2R)-5-(diethylamino)pentan-2-yl]carbamimidate |
| SMILES | CCCO/C(=N\[C@H](C)CCCN(CC)CC)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H31Cl2N3O2/c1-5-13-27-20(23-15(4)9-8-12-25(6-2)7-3)24-19(26)16-10-11-17(21)18(22)14-16/h10-11,14-15H,5-9,12-13H2,1-4H3,(H,23,24,26)/t15-/m1/s1 |
| InChIKey | MCMVJXSUAXASKV-OAHLLOKOSA-N |
| XLogP | 5.02 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|