C16H23Cl2NO — CID 129389098
(2R)-1-(3,4-dichlorophenyl)-2-(diethylaminomethyl)pentan-1-one (PubChem CID 129389098) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is (2R)-1-(3,4-dichlorophenyl)-2-(diethylaminomethyl)pentan-1-one.
| Compound Name | (2R)-1-(3,4-dichlorophenyl)-2-(diethylaminomethyl)pentan-1-one |
|---|---|
| PubChem CID | 129389098 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2R)-1-(3,4-dichlorophenyl)-2-(diethylaminomethyl)pentan-1-one |
| SMILES | CCC[C@H](CN(CC)CC)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-4-7-13(11-19(5-2)6-3)16(20)12-8-9-14(17)15(18)10-12/h8-10,13H,4-7,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | IKXYTHOXNDLHHG-CYBMUJFWSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |