C12H14Cl2O3 — CID 79495539
1-(3,4-dichlorophenyl)-2,2-diethoxyethanone (PubChem CID 79495539) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,2-diethoxyethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2,2-diethoxyethanone |
|---|---|
| PubChem CID | 79495539 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,2-diethoxyethanone |
| SMILES | CCOC(OCC)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2O3/c1-3-16-12(17-4-2)11(15)8-5-6-9(13)10(14)7-8/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | VDQRMCLWPJXZMY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|