C13H17Cl2NO3 — CID 70798999
3,4-dichloro-N-[(3S)-3-ethoxy-4-hydroxybutyl]benzamide (PubChem CID 70798999) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3S)-3-ethoxy-4-hydroxybutyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(3S)-3-ethoxy-4-hydroxybutyl]benzamide |
|---|---|
| PubChem CID | 70798999 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3,4-dichloro-N-[(3S)-3-ethoxy-4-hydroxybutyl]benzamide |
| SMILES | CCO[C@H](CO)CCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO3/c1-2-19-10(8-17)5-6-16-13(18)9-3-4-11(14)12(15)7-9/h3-4,7,10,17H,2,5-6,8H2,1H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | CYUJGMIALFSWLN-JTQLQIEISA-N |
| XLogP | 2.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |